
CAS 1261959-42-5
:3′-Chloro-5′-fluoro-3-nitro[1,1′-biphenyl]-4-carboxylic acid
Description:
3′-Chloro-5′-fluoro-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, participating in various chemical reactions, including esterification and amidation. The compound features three substituents: a chlorine atom at the 3′ position, a fluorine atom at the 5′ position, and a nitro group (-NO2) at the 3 position of the biphenyl framework. These substituents can significantly influence the compound's reactivity, polarity, and solubility. The nitro group is known for its electron-withdrawing properties, which can enhance the acidity of the carboxylic acid. Additionally, the presence of halogens like chlorine and fluorine can affect the compound's biological activity and potential applications in pharmaceuticals or agrochemicals. Overall, this compound's unique structure and functional groups make it of interest in various fields of chemical research and development.
Formula:C13H7ClFNO4
InChI:InChI=1S/C13H7ClFNO4/c14-9-3-8(4-10(15)6-9)7-1-2-11(13(17)18)12(5-7)16(19)20/h1-6H,(H,17,18)
InChI key:InChIKey=PAUSJASMBVFYCJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1C(O)=O)C2=CC(Cl)=CC(F)=C2
Synonyms:- 3′-Chloro-5′-fluoro-3-nitro[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 3′-chloro-5′-fluoro-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.