CymitQuimica logo

CAS 1261959-55-0

:

2-Fluoro-5-(2-furanyl)phenol

Description:
2-Fluoro-5-(2-furanyl)phenol is an organic compound characterized by the presence of a fluorine atom and a furanyl group attached to a phenolic structure. The compound features a phenol moiety, which is known for its hydroxyl (-OH) group that imparts acidity and reactivity, particularly in electrophilic substitution reactions. The presence of the fluorine atom at the 2-position enhances the compound's reactivity and can influence its electronic properties, making it potentially useful in various chemical applications. The furanyl group, derived from furan, contributes to the compound's aromatic character and can participate in further chemical transformations. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its solubility and stability in different solvents can vary, affecting its practical applications in synthesis and formulation. Overall, 2-Fluoro-5-(2-furanyl)phenol represents a unique structure that combines elements of both aromatic and heterocyclic chemistry.
Formula:C10H7FO2
InChI:InChI=1S/C10H7FO2/c11-8-4-3-7(6-9(8)12)10-2-1-5-13-10/h1-6,12H
InChI key:InChIKey=PAFYPRMODPMRJC-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1F)C2=CC=CO2
Synonyms:
  • Phenol, 2-fluoro-5-(2-furanyl)-
  • 2-Fluoro-5-(2-furanyl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.