
CAS 1261959-58-3
:3-Fluoro-4-(3-thienyl)phenol
Description:
3-Fluoro-4-(3-thienyl)phenol is an organic compound characterized by the presence of a fluorine atom, a phenolic hydroxyl group, and a thienyl substituent. The molecular structure features a phenol ring, which contributes to its potential as a weak acid due to the hydroxyl group, and the thienyl group, which introduces heteroatoms and can influence the compound's reactivity and solubility. The fluorine atom is known to enhance the compound's lipophilicity and can affect its electronic properties, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of both the thienyl and fluorine groups may also impart unique biological activities, making it a candidate for further research in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the arrangement of substituents, which may affect its interactions with other molecules. Overall, 3-Fluoro-4-(3-thienyl)phenol is a compound of interest due to its structural features and potential applications in various fields of chemistry.
Formula:C10H7FOS
InChI:InChI=1S/C10H7FOS/c11-10-5-8(12)1-2-9(10)7-3-4-13-6-7/h1-6,12H
InChI key:InChIKey=PERMPBHNLYVPTF-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=CSC2)C=CC(O)=C1
Synonyms:- 3-Fluoro-4-(3-thienyl)phenol
- Phenol, 3-fluoro-4-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.