CAS 1261959-76-5

2-Chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid

Description:

2-Chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. The presence of a chloro group and a fluoro group indicates that it is a halogenated compound, which can influence its reactivity and biological activity. The methoxy group contributes to its overall polarity and can affect solubility in various solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its carboxylic acid functional group suggests potential for hydrogen bonding and interactions with biological targets. Additionally, the specific arrangement of substituents on the aromatic rings can lead to unique electronic properties, impacting its behavior in chemical reactions. Overall, 2-Chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its applications and effects.

Formula: C₁₃H₉ClFNO₃

InChI: InChI=1S/C13H9ClFNO3/c1-19-10-4-2-3-8(11(10)15)7-5-9(13(17)18)12(14)16-6-7/h2-6H,1H3,(H,17,18)

InChI key: InChIKey=UDDNSIOFLUOGFG-UHFFFAOYSA-N

SMILES: FC1=C(C=2C=C(C(O)=O)C(Cl)=NC2)C=CC=C1OC

Synonyms:

• 3-Pyridinecarboxylic acid, 2-chloro-5-(2-fluoro-3-methoxyphenyl)-
• 2-Chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinecarboxylic acid