CAS 1261959-91-4

5′-Cyano-2′-fluoro-3-methoxy[1,1′-biphenyl]-4-carboxylic acid

Description:

5′-Cyano-2′-fluoro-3-methoxy[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which includes a cyano group, a fluoro substituent, and a methoxy group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the cyano group indicates potential reactivity and the ability to participate in nucleophilic reactions, while the fluoro substituent can enhance lipophilicity and influence biological activity. The methoxy group may also affect the compound's solubility and reactivity. Overall, this compound is likely to exhibit interesting chemical behavior due to the interplay of its functional groups, making it a candidate for various applications in pharmaceuticals or materials science. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental methods or detailed literature review, as they are not universally defined and can vary based on environmental conditions.

Formula: C₁₅H₁₀FNO₃

InChI: InChI=1S/C15H10FNO3/c1-20-14-7-10(3-4-11(14)15(18)19)12-6-9(8-17)2-5-13(12)16/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=XAOSRVGUQDFXJT-UHFFFAOYSA-N

SMILES: FC=1C(=CC(C#N)=CC1)C2=CC(OC)=C(C(O)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 5′-cyano-2′-fluoro-3-methoxy-
• 5′-Cyano-2′-fluoro-3-methoxy[1,1′-biphenyl]-4-carboxylic acid