CAS 1261960-18-2

6-(5-Chloro-2-methoxyphenyl)-3-pyridinecarboxylic acid

Description:

6-(5-Chloro-2-methoxyphenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261960-18-2, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro substituent and a methoxy group on the phenyl ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of both electron-withdrawing (chloro) and electron-donating (methoxy) groups can affect the acidity and overall stability of the compound. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be influenced by these functional groups, making it a subject of interest for further study in medicinal chemistry and related fields.

Formula: C₁₃H₁₀ClNO₃

InChI: InChI=1S/C13H10ClNO3/c1-18-12-5-3-9(14)6-10(12)11-4-2-8(7-15-11)13(16)17/h2-7H,1H3,(H,16,17)

InChI key: InChIKey=MMMMTIHBFZTQPT-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(Cl)C=C1)C2=CC=C(C(O)=O)C=N2

Synonyms:

• 6-(5-Chloro-2-methoxyphenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-(5-chloro-2-methoxyphenyl)-