CAS 1261960-75-1

3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile

Description:

3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a hydroxy group at the 5′ position contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The carbonitrile functional group at the 3 position enhances its polarity and can influence its solubility and interaction with biological systems. This compound may exhibit specific biological activities due to its structural features, making it of interest for research in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and its properties can be further explored through techniques such as spectroscopy and chromatography. As with many chemical substances, safety and handling precautions are essential, given the potential hazards associated with its components. Overall, 3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile represents a unique structure with diverse implications in chemical research.

Formula: C₁₃H₈ClNO

InChI: InChI=1S/C13H8ClNO/c14-12-5-11(6-13(16)7-12)10-3-1-2-9(4-10)8-15/h1-7,16H

InChI key: InChIKey=FPSHKIAAAUVLNN-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1)C2=CC(Cl)=CC(O)=C2

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 3′-chloro-5′-hydroxy-
• 3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile