CAS 1261960-94-4

5-Amino-2′-formyl[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Amino-2′-formyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an amino group (-NH2), a formyl group (-CHO), and a carboxylic acid group (-COOH), contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of these functional groups allows for various chemical reactions, such as amide formation, esterification, and condensation reactions. The compound's structure suggests it may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding, and the ability to participate in electrophilic aromatic substitution reactions. Additionally, the presence of the amino group may impart basicity, while the carboxylic acid group can act as an acid, making it a versatile building block in the synthesis of more complex molecules. Its specific applications would depend on its reactivity and the context of its use in chemical research or industry.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1S/C14H11NO3/c15-12-6-10(5-11(7-12)14(17)18)13-4-2-1-3-9(13)8-16/h1-8H,15H2,(H,17,18)

InChI key: InChIKey=UYKDJFHCBYYYAJ-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C=CC=C1)C2=CC(C(O)=O)=CC(N)=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-amino-2′-formyl-
• 5-Amino-2′-formyl[1,1′-biphenyl]-3-carboxylic acid