CAS 1261961-08-3

5-Hydroxy-2′,5′-dimethyl[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Hydroxy-2′,5′-dimethyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) that contribute to its chemical reactivity and solubility in polar solvents. The presence of two methyl groups at the 2' and 5' positions enhances its hydrophobic characteristics while also influencing its steric properties. This compound may exhibit biological activity, potentially serving as an intermediate in organic synthesis or as a building block for more complex molecules. Its specific applications and interactions would depend on its functional groups and overall molecular structure. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use. Further studies may be required to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-9-3-4-10(2)14(5-9)11-6-12(15(17)18)8-13(16)7-11/h3-8,16H,1-2H3,(H,17,18)

InChI key: InChIKey=ROMYLLGALACNEY-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C(O)=O)=CC(O)=C2)C=C(C)C=C1

Synonyms:

• 5-Hydroxy-2′,5′-dimethyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 5-hydroxy-2′,5′-dimethyl-