CAS 1261961-22-1

3-Methoxy-4′-(1-piperidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

3-Methoxy-4′-(1-piperidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a methoxy group, a carboxylic acid group, and a piperidinylsulfonyl moiety. This compound is typically classified as an organic sulfonamide, which may exhibit various biological activities due to its structural features. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The methoxy and carboxylic acid functional groups contribute to its solubility and reactivity, influencing its pharmacokinetic properties. Additionally, the biphenyl structure can enhance lipophilicity, which may affect the compound's ability to cross biological membranes. Overall, this compound's unique combination of functional groups and structural elements positions it as a candidate for further research in drug development and therapeutic applications.

Formula: C₁₉H₂₁NO₅S

InChI: InChI=1S/C19H21NO5S/c1-25-18-13-15(7-10-17(18)19(21)22)14-5-8-16(9-6-14)26(23,24)20-11-3-2-4-12-20/h5-10,13H,2-4,11-12H2,1H3,(H,21,22)

InChI key: InChIKey=UVAKEWFSPQBERG-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(C=C1)C2=CC(OC)=C(C(O)=O)C=C2)N3CCCCC3

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 3-methoxy-4′-(1-piperidinylsulfonyl)-
• 3-Methoxy-4′-(1-piperidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid