CymitQuimica logo

CAS 1261961-38-9

:

4-Chloro-4′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol

Description:
4-Chloro-4′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple halogen substituents, including a chlorine atom and a fluorine atom, as well as a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the hydroxyl (-OH) group indicates that it is a phenolic compound, which can participate in hydrogen bonding and may exhibit varying solubility in polar and nonpolar solvents. The trifluoromethyl group contributes to the compound's lipophilicity and can enhance its biological activity. Additionally, the specific arrangement of substituents on the biphenyl framework can affect its electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic and applied chemistry.
Formula:C13H7ClF4O
InChI:InChI=1S/C13H7ClF4O/c14-10-3-1-8(6-12(10)19)7-2-4-11(15)9(5-7)13(16,17)18/h1-6,19H
InChI key:InChIKey=HKTQOUZJCCZQMZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1F)C2=CC(O)=C(Cl)C=C2
Synonyms:
  • 4-Chloro-4′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 4-chloro-4′-fluoro-3′-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.