
CAS 1261961-54-9
:5-Chloro-3′-(phenylmethoxy)[1,1′-biphenyl]-3-ol
Description:
5-Chloro-3′-(phenylmethoxy)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 5-position and a phenylmethoxy group at the 3′-position contributes to its unique chemical properties. This compound features a hydroxyl (-OH) group at the 3-position, which can influence its solubility and reactivity, making it potentially useful in various chemical reactions, including those involving nucleophilic substitution or hydrogen bonding. The chlorine substituent may also enhance the compound's lipophilicity and alter its electronic properties, affecting its interactions with biological systems. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, 5-Chloro-3′-(phenylmethoxy)[1,1′-biphenyl]-3-ol represents a complex structure with potential applications in medicinal chemistry and materials science.
Formula:C19H15ClO2
InChI:InChI=1S/C19H15ClO2/c20-17-9-16(10-18(21)12-17)15-7-4-8-19(11-15)22-13-14-5-2-1-3-6-14/h1-12,21H,13H2
InChI key:InChIKey=ZDECBPIIEGCREG-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(O)C1)C2=CC(OCC3=CC=CC=C3)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 5-chloro-3′-(phenylmethoxy)-
- 5-Chloro-3′-(phenylmethoxy)[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.