CymitQuimica logo

CAS 1261961-59-4

:

2-Chloro-5-(5-formyl-3-thienyl)benzoic acid

Description:
2-Chloro-5-(5-formyl-3-thienyl)benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chloro group and a thienyl group that carries an aldehyde functional group. The presence of the chloro substituent typically influences the compound's reactivity and solubility, while the thienyl group contributes to its aromatic properties and potential for various chemical interactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The compound's properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the chloro group, which can pose health risks.
Formula:C12H7ClO3S
InChI:InChI=1S/C12H7ClO3S/c13-11-2-1-7(4-10(11)12(15)16)8-3-9(5-14)17-6-8/h1-6H,(H,15,16)
InChI key:InChIKey=NWVHUCWBZXCGLR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1Cl)C=2C=C(C=O)SC2
Synonyms:
  • Benzoic acid, 2-chloro-5-(5-formyl-3-thienyl)-
  • 2-Chloro-5-(5-formyl-3-thienyl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.