
CAS 1261961-89-0
:4′,5-Dimethyl[1,1′-biphenyl]-3-ol
Description:
4′,5-Dimethyl[1,1′-biphenyl]-3-ol, identified by its CAS number 1261961-89-0, is an organic compound characterized by its biphenyl structure with two methyl groups located at the 4 and 5 positions and a hydroxyl group (-OH) at the 3 position. This compound is part of a class of chemicals known as phenols, which are known for their aromatic properties and potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group contributes to its polarity, influencing its solubility in polar solvents and its reactivity in chemical reactions. Additionally, the methyl substituents can affect the compound's steric hindrance and electronic properties, potentially impacting its biological activity and interactions with other molecules. Overall, 4′,5-Dimethyl[1,1′-biphenyl]-3-ol exhibits characteristics typical of substituted phenolic compounds, making it of interest for further research and application in synthetic chemistry and related disciplines.
Formula:C14H14O
InChI:InChI=1S/C14H14O/c1-10-3-5-12(6-4-10)13-7-11(2)8-14(15)9-13/h3-9,15H,1-2H3
InChI key:InChIKey=SNQIQCBVPAVQKB-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(O)C1)C2=CC=C(C)C=C2
Synonyms:- 3-Methyl-5-(4-methylphenyl)phenol
- 4′,5-Dimethyl[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 4′,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.