
CAS 1261962-07-5
:4-Chloro-4′-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carbonitrile
Description:
4-Chloro-4′-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a chloro group, a fluoro group, a hydroxy group, and a carbonitrile group, which contribute to its chemical reactivity and potential applications. The presence of the chloro and fluoro substituents suggests that it may exhibit unique electronic properties, potentially influencing its behavior in various chemical reactions. The hydroxy group can participate in hydrogen bonding, enhancing its solubility in polar solvents. The carbonitrile group is known for its ability to act as a strong electron-withdrawing group, which can affect the compound's acidity and reactivity. Overall, this compound may be of interest in fields such as pharmaceuticals, agrochemicals, or materials science due to its diverse functional groups and structural characteristics. However, specific applications and safety considerations would depend on further research and analysis.
Formula:C13H7ClFNO
InChI:InChI=1S/C13H7ClFNO/c14-11-3-1-8(5-10(11)7-16)9-2-4-12(15)13(17)6-9/h1-6,17H
InChI key:InChIKey=MOXJGALUHAXTLR-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1Cl)C2=CC(O)=C(F)C=C2
Synonyms:- [1,1′-Biphenyl]-3-carbonitrile, 4-chloro-4′-fluoro-3′-hydroxy-
- 4-Chloro-4′-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.