CAS 1261962-10-0

4-(3-Cyano-2-fluorophenyl)-3-pyridinecarboxylic acid

Description:

4-(3-Cyano-2-fluorophenyl)-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and a cyano group. The presence of the cyano group (-C≡N) contributes to its potential as a building block in various chemical syntheses, while the fluorine atom enhances its reactivity and may influence its electronic properties. The carboxylic acid functional group (-COOH) provides acidic characteristics, allowing for potential interactions in biological systems or as a ligand in coordination chemistry. This compound may exhibit polar characteristics due to the presence of both the cyano and carboxylic acid groups, which can affect its solubility in different solvents. Additionally, the specific arrangement of substituents on the aromatic rings can lead to unique pharmacological properties, making it of interest in medicinal chemistry. Overall, 4-(3-Cyano-2-fluorophenyl)-3-pyridinecarboxylic acid is a versatile compound with potential applications in drug development and material science.

Formula: C₁₃H₇FN₂O₂

InChI: InChI=1S/C13H7FN2O2/c14-12-8(6-15)2-1-3-10(12)9-4-5-16-7-11(9)13(17)18/h1-5,7H,(H,17,18)

InChI key: InChIKey=JZVZGEDYCNWUJG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CC=NC1)C2=C(F)C(C#N)=CC=C2

Synonyms:

• 4-(3-Cyano-2-fluorophenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-(3-cyano-2-fluorophenyl)-