CymitQuimica logo

CAS 1261962-14-4

:

3-[4-(Hydroxymethyl)phenyl]-4-pyridinecarboxylic acid

Description:
3-[4-(Hydroxymethyl)phenyl]-4-pyridinecarboxylic acid, identified by its CAS number 1261962-14-4, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the hydroxymethyl group and the carboxylic acid functional group. The carboxylic acid moiety contributes to its acidity and reactivity, making it a candidate for various chemical reactions, including esterification and amidation. Additionally, the presence of the pyridine ring may impart basic characteristics and influence the compound's biological activity. Overall, this compound's structural complexity suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research into its properties and reactivity.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c15-8-9-1-3-10(4-2-9)12-7-14-6-5-11(12)13(16)17/h1-7,15H,8H2,(H,16,17)
InChI key:InChIKey=RZFUZVWEBAEGAJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=CC=C(CO)C=C2
Synonyms:
  • 4-Pyridinecarboxylic acid, 3-[4-(hydroxymethyl)phenyl]-
  • 3-[4-(Hydroxymethyl)phenyl]-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.