CAS 1261962-24-6

3′-Chloro-5′-fluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid

Description:

3′-Chloro-5′-fluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which features multiple functional groups that contribute to its chemical properties. The presence of a carboxylic acid group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The nitro group (-NO2) is a strong electron-withdrawing group, which can enhance the compound's reactivity, particularly in electrophilic substitution reactions. The chlorine and fluorine substituents on the biphenyl ring introduce additional electronegative characteristics, influencing the compound's polarity and solubility in various solvents. This compound may exhibit interesting biological activities due to its structural features, making it of potential interest in pharmaceutical research. Its specific reactivity and interactions would depend on the surrounding environment and the presence of other chemical species. Overall, 3′-Chloro-5′-fluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid represents a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₃H₇ClFNO₄

InChI: InChI=1S/C13H7ClFNO4/c14-8-3-7(4-9(15)5-8)12-6-10(16(19)20)1-2-11(12)13(17)18/h1-6H,(H,17,18)

InChI key: InChIKey=KSKPESSXMUQTCI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=CC(Cl)=CC(F)=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 3′-chloro-5′-fluoro-5-nitro-
• 3′-Chloro-5′-fluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid