
CAS 1261963-01-2
:3′-Acetyl-2-methyl[1,1′-biphenyl]-4-carboxylic acid
Description:
3′-Acetyl-2-methyl[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an acetyl group at the 3′ position and a carboxylic acid functional group at the 4-position of the biphenyl moiety, along with a methyl group at the 2-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in organic synthesis and pharmaceuticals. The acetyl group can participate in acylation reactions, while the carboxylic acid can engage in acid-base reactions and esterification. The compound's molecular structure suggests it may exhibit interesting physical properties, such as solubility in organic solvents and potential for hydrogen bonding due to the carboxylic acid group. Additionally, its biphenyl framework may impart unique electronic properties, making it a candidate for studies in materials science or medicinal chemistry. Overall, this compound's diverse functional groups and structural features make it a subject of interest in various chemical research fields.
Formula:C16H14O3
InChI:InChI=1S/C16H14O3/c1-10-8-14(16(18)19)6-7-15(10)13-5-3-4-12(9-13)11(2)17/h3-9H,1-2H3,(H,18,19)
InChI key:InChIKey=MKDXADWADOGGKD-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(C(C)=O)=CC=C2)C=CC(C(O)=O)=C1
Synonyms:- 3′-Acetyl-2-methyl[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 3′-acetyl-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.