CAS 1261963-06-7

2′-Fluoro-3-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol

Description:

2′-Fluoro-3-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the para position relative to the biphenyl linkage contributes to its potential as a phenolic compound, influencing its reactivity and solubility in various solvents. The trifluoromethyl group (-CF3) and the fluoro group (-F) introduce significant electronegativity, which can enhance the compound's lipophilicity and alter its electronic properties, making it potentially useful in pharmaceuticals or agrochemicals. The methyl group (-CH3) at the 3-position adds to the steric bulk, which may affect the compound's interactions with biological targets. Overall, the unique combination of functional groups and structural features gives this compound distinctive chemical properties, making it a subject of interest in various fields of research, including medicinal chemistry and materials science.

Formula: C₁₄H₁₀F₄O

InChI: InChI=1S/C14H10F4O/c1-8-7-9(5-6-12(8)19)10-3-2-4-11(13(10)15)14(16,17)18/h2-7,19H,1H3

InChI key: InChIKey=LXJFKQAXOCRWOB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C(=CC=C1)C2=CC(C)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-ol, 2′-fluoro-3-methyl-3′-(trifluoromethyl)-
• 2′-Fluoro-3-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol