CAS 1261963-32-9

3-Methyl 4-fluoro-3′-methoxy[1,1′-biphenyl]-3,4′-dicarboxylate

Description:

3-Methyl 4-fluoro-3′-methoxy[1,1′-biphenyl]-3,4′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group and a fluoro substituent on the biphenyl framework contributes to its unique chemical properties, including potential variations in polarity and reactivity. The methoxy group enhances solubility in organic solvents and may influence the compound's electronic properties. As a dicarboxylate, it contains two carboxylate functional groups, which can participate in various chemical reactions, including esterification and acid-base reactions. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific interactions and stability would depend on environmental conditions such as temperature and pH. Safety data and handling precautions should be consulted due to the presence of fluorine and other functional groups, which may pose health risks or environmental concerns.

Formula: C₁₆H₁₃FO₅

InChI: InChI=1S/C16H13FO5/c1-21-14-8-10(3-5-11(14)15(18)19)9-4-6-13(17)12(7-9)16(20)22-2/h3-8H,1-2H3,(H,18,19)

InChI key: InChIKey=CBYFXUZTMBHJCF-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=CC1F)C2=CC(OC)=C(C(O)=O)C=C2

Synonyms:

• 3-Methyl 4-fluoro-3′-methoxy[1,1′-biphenyl]-3,4′-dicarboxylate
• [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 4-fluoro-3′-methoxy-, 3-methyl ester