CAS 1261963-41-0

6-[4-Methoxy-3-(trifluoromethyl)phenyl]-3-pyridinol

Description:

6-[4-Methoxy-3-(trifluoromethyl)phenyl]-3-pyridinol, identified by its CAS number 1261963-41-0, is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring and a phenyl group substituted with a methoxy and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy group can enhance solubility in organic solvents, while the trifluoromethyl group often contributes to increased lipophilicity and can influence biological activity. The presence of the pyridinol moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets. Additionally, the compound's characteristics may include moderate to high melting and boiling points, depending on its purity and specific structural interactions. Overall, this compound's unique functional groups and structural features make it of interest in various chemical and pharmaceutical research contexts.

Formula: C₁₃H₁₀F₃NO₂

InChI: InChI=1S/C13H10F3NO2/c1-19-12-5-2-8(6-10(12)13(14,15)16)11-4-3-9(18)7-17-11/h2-7,18H,1H3

InChI key: InChIKey=ADQWVMHIMYLIPW-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1OC)C2=CC=C(O)C=N2

Synonyms:

• 3-Pyridinol, 6-[4-methoxy-3-(trifluoromethyl)phenyl]-
• 6-[4-Methoxy-3-(trifluoromethyl)phenyl]-3-pyridinol