CAS 1261963-55-6

2-Fluoro-3′-methyl[1,1′-biphenyl]-4-ol

Description:

2-Fluoro-3′-methyl[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 4-position and a fluorine atom at the 2-position of one of the phenyl rings contributes to its chemical reactivity and potential applications. The methyl group at the 3′ position further influences its steric and electronic properties. This compound may exhibit interesting biological activities due to the presence of the hydroxyl group, which can participate in hydrogen bonding and affect solubility in polar solvents. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability. The compound's molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₃H₁₁FO

InChI: InChI=1S/C13H11FO/c1-9-3-2-4-10(7-9)12-6-5-11(15)8-13(12)14/h2-8,15H,1H3

InChI key: InChIKey=PVQPADGLTQJTBO-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(C)=CC=C2)C=CC(O)=C1

Synonyms:

• 2-Fluoro-3′-methyl[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 2-fluoro-3′-methyl-