CAS 1261963-60-3

3-Methyl 3′-chloro-4-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate

Description:

3-Methyl 3′-chloro-4-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group, a chlorine atom, and a fluorine atom on the biphenyl framework contributes to its unique chemical properties. This compound features two carboxylate ester functional groups, which enhance its reactivity and solubility in various organic solvents. The chlorine and fluorine substituents can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the presence of multiple functional groups suggests potential applications in organic synthesis, pharmaceuticals, or materials science. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, 3-Methyl 3′-chloro-4-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate represents a complex organic molecule with diverse potential applications in various fields of chemistry.

Formula: C₁₅H₁₀ClFO₄

InChI: InChI=1S/C15H10ClFO4/c1-21-15(20)11-6-8(3-5-13(11)17)9-2-4-10(14(18)19)12(16)7-9/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=MNOZQJXRKBKHOT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=CC1F)C2=CC(Cl)=C(C(O)=O)C=C2

Synonyms:

• 3-Methyl 3′-chloro-4-fluoro[1,1′-biphenyl]-3,4′-dicarboxylate
• [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 3′-chloro-4-fluoro-, 3-methyl ester