![4′-Chloro-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid](https://static.cymitquimica.com/cas-image/181789-4-chloro-5-trifluoromethyl-11-biphenyl-3-carboxylic-acid.png)
CAS 1261964-03-7: 4′-Chloro-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Description:4′-Chloro-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the para position and a trifluoromethyl group at the meta position on one of the phenyl rings significantly influences its chemical properties, including its reactivity and polarity. The carboxylic acid functional group at the 3-position contributes to its acidity and solubility in polar solvents. This compound is likely to exhibit strong intermolecular interactions due to the electronegative chlorine and fluorine substituents, which can enhance its potential applications in pharmaceuticals, agrochemicals, or materials science. Additionally, the trifluoromethyl group is known to impart unique electronic properties, making the compound of interest in various chemical syntheses and research applications. Overall, its structural features suggest a compound with potential utility in diverse chemical contexts.
Formula:C14H8ClF3O2
InChI:InChI=1S/C14H8ClF3O2/c15-12-3-1-8(2-4-12)9-5-10(13(19)20)7-11(6-9)14(16,17)18/h1-7H,(H,19,20)
InChI key:InChIKey=RBRCLVVUOBMDBO-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C=C(C1)C(F)(F)F)C=2C=CC(Cl)=CC2
- Synonyms:
- 4′-Chloro-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-chloro-5-(trifluoromethyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | [1,1'-Biphenyl]-3-carboxylic acid, 4'-chloro-5-(trifluoromethyl)- REF: IN-DA000S9HCAS: 1261964-03-7 | - - - | To inquire | Fri 28 Mar 25 |
 | 4'-Chloro-5-(trifluoromethyl)-[1,1'-biphenyl]-3-carboxylic acid REF: 10-F217321CAS: 1261964-03-7 | 95.0% | - - - | Discontinued product |
 | 3-(4-Chlorophenyl)-5-trifluoromethylbenzoic acid REF: 3D-LAC96403CAS: 1261964-03-7 | Min. 95% | - - - | Discontinued product |
![[1,1'-Biphenyl]-3-carboxylic acid, 4'-chloro-5-(trifluoromethyl)-](https://static.cymitquimica.com/products/IN/thumb/DA000S9H.jpg)
[1,1'-Biphenyl]-3-carboxylic acid, 4'-chloro-5-(trifluoromethyl)-
Ref: IN-DA000S9H
| Undefined size | To inquire |
![4'-Chloro-5-(trifluoromethyl)-[1,1'-biphenyl]-3-carboxylic acid](https://static.cymitquimica.com/products/10/thumb/F217321.jpg)
4'-Chloro-5-(trifluoromethyl)-[1,1'-biphenyl]-3-carboxylic acid
Ref: 10-F217321
| 1g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
3-(4-Chlorophenyl)-5-trifluoromethylbenzoic acid
Ref: 3D-LAC96403
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
