CymitQuimica logo

CAS 1261964-14-0

:

Methyl 3′-cyano-4′-hydroxy[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 3′-cyano-4′-hydroxy[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a cyano group (-CN) and a hydroxyl group (-OH) attached to the biphenyl framework, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the carboxylate group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity. The compound's molecular structure suggests it may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the functional groups. Additionally, the cyano and hydroxyl groups can participate in hydrogen bonding and other intermolecular interactions, which may affect its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, this compound's unique structural features make it a subject of interest for further research and potential applications.
Formula:C15H11NO3
InChI:InChI=1S/C15H11NO3/c1-19-15(18)12-4-2-3-10(7-12)11-5-6-14(17)13(8-11)9-16/h2-8,17H,1H3
InChI key:InChIKey=MDPRLWHERLAURO-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1O)C2=CC(C(OC)=O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-cyano-4′-hydroxy-, methyl ester
  • Methyl 3′-cyano-4′-hydroxy[1,1′-biphenyl]-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.