CAS 1261964-19-5

3-Chloro-3′-fluoro[1,1′-biphenyl]-4,4′-dicarboxylic acid

Description:

3-Chloro-3′-fluoro[1,1′-biphenyl]-4,4′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom and a fluorine atom at the 3-position of the biphenyl framework contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The dicarboxylic acid functional groups at the 4 and 4' positions enhance its acidity and ability to form hydrogen bonds, making it useful in various chemical applications, including as a building block in organic synthesis and materials science. The compound's molecular structure allows for potential interactions in biological systems, which may be of interest in pharmaceutical research. Additionally, its specific substitutions may influence its physical properties, such as melting point, boiling point, and solubility in different solvents. Overall, this compound exemplifies the complexity and versatility of halogenated aromatic compounds in organic chemistry.

Formula: C₁₄H₈ClFO₄

InChI: InChI=1S/C14H8ClFO4/c15-11-5-7(1-3-9(11)13(17)18)8-2-4-10(14(19)20)12(16)6-8/h1-6H,(H,17,18)(H,19,20)

InChI key: InChIKey=MFEASKHAYHUMIN-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C(O)=O)C2=CC(F)=C(C(O)=O)C=C2

Synonyms:

• 3-Chloro-3′-fluoro[1,1′-biphenyl]-4,4′-dicarboxylic acid
• [1,1′-Biphenyl]-4,4′-dicarboxylic acid, 3-chloro-3′-fluoro-

4-(4-Carboxy-3-fluorophenyl)-2-chlorobenzoic acid

CAS: 1261964-19-5

Formula: C₁₄H₈ClFO₄

Molecular weight: 294.6623

Ref: IN-DA000S9F