
CAS 1261964-24-2
:Methyl 3′-cyano-4′-hydroxy[1,1′-biphenyl]-4-carboxylate
Description:
Methyl 3′-cyano-4′-hydroxy[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a hydroxy group (-OH) on the biphenyl framework contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The carboxylate group (-COOCH3) indicates that it is a methyl ester, which can influence its solubility and reactivity. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets due to its functional groups. Additionally, the presence of multiple substituents can lead to diverse chemical behavior, making it a candidate for further research in synthetic chemistry or as a building block in organic synthesis. Its CAS number, 1261964-24-2, uniquely identifies this compound in chemical databases, facilitating its study and application in various scientific contexts.
Formula:C15H11NO3
InChI:InChI=1S/C15H11NO3/c1-19-15(18)11-4-2-10(3-5-11)12-6-7-14(17)13(8-12)9-16/h2-8,17H,1H3
InChI key:InChIKey=LJKWLWBLMZEXNR-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1O)C2=CC=C(C(OC)=O)C=C2
Synonyms:- Methyl 3′-cyano-4′-hydroxy[1,1′-biphenyl]-4-carboxylate
- [1,1′-Biphenyl]-4-carboxylic acid, 3′-cyano-4′-hydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.