
CAS 1261964-47-9
:N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)acetamide
Description:
N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)acetamide is a chemical compound characterized by its biphenyl structure, which features a bromine atom and a hydroxyl group at specific positions on the biphenyl moiety. This compound is classified as an acetamide due to the presence of the acetamide functional group (-C(=O)NH2) attached to the biphenyl structure. The bromine substituent typically enhances the compound's reactivity and can influence its biological activity, while the hydroxyl group may contribute to hydrogen bonding and solubility in polar solvents. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure may also exhibit specific stereochemical properties, affecting its interaction with biological targets. Overall, N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)acetamide represents a complex organic molecule with potential significance in various chemical and biological contexts.
Formula:C14H12BrNO2
InChI:InChI=1S/C14H12BrNO2/c1-9(17)16-13-4-2-3-10(6-13)11-5-12(15)8-14(18)7-11/h2-8,18H,1H3,(H,16,17)
InChI key:InChIKey=YWISZBVZZXPHPT-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C(C=CC1)C2=CC(Br)=CC(O)=C2
Synonyms:- N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)acetamide
- Acetamide, N-(3′-bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.