CAS 1261964-63-9

5-(Trifluoromethyl)[1,1′-biphenyl]-3,4′-diol

Description:

5-(Trifluoromethyl)[1,1′-biphenyl]-3,4′-diol is an organic compound characterized by the presence of a biphenyl structure substituted with a trifluoromethyl group and two hydroxyl (–OH) groups. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and solubility. The hydroxyl groups contribute to the compound's potential as a hydrogen bond donor, enhancing its solubility in polar solvents and affecting its interaction with biological systems. This compound may exhibit interesting properties such as potential antioxidant activity or serve as a building block in organic synthesis. Its unique structure makes it a subject of interest in various fields, including materials science and medicinal chemistry. Additionally, the presence of fluorine atoms often enhances the stability and lipophilicity of the compound, which can be advantageous in drug design and development. Overall, 5-(Trifluoromethyl)[1,1′-biphenyl]-3,4′-diol represents a versatile chemical entity with potential applications in research and industry.

Formula: C₁₃H₉F₃O₂

InChI: InChI=1S/C13H9F3O2/c14-13(15,16)10-5-9(6-12(18)7-10)8-1-3-11(17)4-2-8/h1-7,17-18H

InChI key: InChIKey=LHOAXWUBQNAFJU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(O)C1)C2=CC=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,4′-diol, 5-(trifluoromethyl)-
• 5-(Trifluoromethyl)[1,1′-biphenyl]-3,4′-diol