CymitQuimica logo

CAS 1261964-86-6

:

4′-Fluoro-3′-methoxy-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol

Description:
4′-Fluoro-3′-methoxy-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a hydroxyl group (-OH), a methoxy group (-OCH3), and a trifluoromethoxy group (-OCF3), which contribute to its chemical reactivity and potential applications. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and material science. The compound's molecular structure suggests it may exhibit unique electronic properties due to the electron-withdrawing effects of the trifluoromethoxy group and the electron-donating effects of the methoxy group. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. Overall, this compound's distinctive features make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C14H10F4O3
InChI:InChI=1S/C14H10F4O3/c1-20-13-6-8(2-3-12(13)15)9-4-10(19)7-11(5-9)21-14(16,17)18/h2-7,19H,1H3
InChI key:InChIKey=RXLQYHCNFVVIQB-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C=C(O)C1)C2=CC(OC)=C(F)C=C2
Synonyms:
  • 4′-Fluoro-3′-methoxy-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 4′-fluoro-3′-methoxy-5-(trifluoromethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.