CAS 1261965-23-4

2′,5′-Difluoro-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid

Description:

2′,5′-Difluoro-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2′ and 5′ positions, along with a hydroxyl group at the 5 position and a carboxylic acid group at the 3 position, contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the hydroxyl and carboxylic acid functional groups, which can engage in hydrogen bonding. The fluorine substituents may influence the compound's reactivity and stability, potentially enhancing its lipophilicity and altering its electronic properties. Such modifications can affect its behavior in biological systems, making it of interest in medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where the specific functional groups can play a crucial role in biological activity and interaction with target molecules.

Formula: C₁₃H₈F₂O₃

InChI: InChI=1S/C13H8F2O3/c14-9-1-2-12(15)11(6-9)7-3-8(13(17)18)5-10(16)4-7/h1-6,16H,(H,17,18)

InChI key: InChIKey=KPUFFHAXOOCFSU-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(C(O)=O)=CC(O)=C2)C=C(F)C=C1

Synonyms:

• 2′,5′-Difluoro-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′,5′-difluoro-5-hydroxy-