
CAS 1261965-86-9
:6-(2-Chloro-5-methoxyphenyl)-3-pyridinecarboxylic acid
Description:
6-(2-Chloro-5-methoxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro substituent and a methoxy group on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), would be essential for its identification and characterization in laboratory settings. Additionally, safety data sheets would provide information on handling, storage, and potential hazards associated with this substance. Overall, 6-(2-Chloro-5-methoxyphenyl)-3-pyridinecarboxylic acid represents a valuable compound for research in various chemical and pharmaceutical applications.
Formula:C13H10ClNO3
InChI:InChI=1S/C13H10ClNO3/c1-18-9-3-4-11(14)10(6-9)12-5-2-8(7-15-12)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=QZXVTVUXMQSZRS-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(OC)=CC1)C2=CC=C(C(O)=O)C=N2
Synonyms:- 3-Pyridinecarboxylic acid, 6-(2-chloro-5-methoxyphenyl)-
- 6-(2-Chloro-5-methoxyphenyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.