CymitQuimica logo

CAS 1261966-50-0

:

3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-carboxylic acid

Description:
3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethoxy group (-OCH2CH3) at the 3′ position and a nitro group (-NO2) at the 3 position of the biphenyl framework contributes to its chemical reactivity and polarity. Additionally, the carboxylic acid functional group (-COOH) at the 4 position enhances its acidity and solubility in polar solvents. This compound may exhibit various properties such as potential biological activity, making it of interest in pharmaceutical and chemical research. Its molecular structure suggests that it could participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitro group and the electron-donating effect of the ethoxy group. Overall, the combination of these functional groups influences its chemical behavior, solubility, and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C15H13NO5
InChI:InChI=1S/C15H13NO5/c1-2-21-12-5-3-4-10(8-12)11-6-7-13(15(17)18)14(9-11)16(19)20/h3-9H,2H2,1H3,(H,17,18)
InChI key:InChIKey=YGLASTZBKRAIPN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1C(O)=O)C2=CC(OCC)=CC=C2
Synonyms:
  • 3′-Ethoxy-3-nitro[1,1′-biphenyl]-4-carboxylic acid
  • [1,1′-Biphenyl]-4-carboxylic acid, 3′-ethoxy-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.