
CAS 1261966-60-2
:2-Methyl-3′-nitro[1,1′-biphenyl]-4-carboxylic acid
Description:
2-Methyl-3′-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group (-COOH) indicates that it can act as an acid, contributing to its solubility in polar solvents. The nitro group (-NO2) at the 3′ position and the methyl group (-CH3) at the 2 position on the biphenyl framework influence its electronic properties and reactivity, potentially enhancing its electrophilic character. This compound may exhibit various chemical behaviors, including participation in electrophilic aromatic substitution reactions due to the activating and deactivating effects of the substituents. Additionally, the presence of both the nitro and carboxylic acid groups suggests potential applications in pharmaceuticals or agrochemicals, where such functionalities are often desirable. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for precise applications.
Formula:C14H11NO4
InChI:InChI=1S/C14H11NO4/c1-9-7-11(14(16)17)5-6-13(9)10-3-2-4-12(8-10)15(18)19/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=WXEUCUCXQKNDEQ-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(N(=O)=O)=CC=C2)C=CC(C(O)=O)=C1
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 2-methyl-3′-nitro-
- 2-Methyl-3′-nitro[1,1′-biphenyl]-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.