CAS 1261966-69-1

2′-Chloro-4′-ethoxy-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde

Description:

2′-Chloro-4′-ethoxy-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a chloro group, an ethoxy group, a hydroxy group, and an aldehyde group, contributing to its chemical reactivity and potential applications. The presence of the chloro substituent can influence the compound's electronic properties and reactivity, while the ethoxy group may enhance solubility in organic solvents. The hydroxy group can participate in hydrogen bonding, affecting the compound's physical properties such as boiling and melting points. Additionally, the aldehyde functional group is known for its reactivity in condensation reactions and can serve as a precursor for further chemical modifications. Overall, this compound's unique combination of substituents makes it of interest in various fields, including medicinal chemistry and materials science, where it may be explored for its potential biological activities or as a building block for more complex molecules.

Formula: C₁₅H₁₃ClO₃

InChI: InChI=1S/C15H13ClO3/c1-2-19-12-5-6-13(14(16)8-12)10-3-4-11(9-17)15(18)7-10/h3-9,18H,2H2,1H3

InChI key: InChIKey=PJAMURTWQFWHFK-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(O)=C(C=O)C=C2)C=CC(OCC)=C1

Synonyms:

• [1,1′-Biphenyl]-4-carboxaldehyde, 2′-chloro-4′-ethoxy-3-hydroxy-
• 2′-Chloro-4′-ethoxy-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde