CAS 1261966-89-5

3-(3-Aminophenyl)-4-pyridinecarboxylic acid

Description:

3-(3-Aminophenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261966-89-5, is an organic compound featuring both an amino group and a carboxylic acid functional group, which contributes to its potential as a bioactive molecule. This compound consists of a pyridine ring substituted with a carboxylic acid and an aniline moiety, which enhances its solubility and reactivity. The presence of the amino group allows for hydrogen bonding and can influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific receptors or enzymes. Additionally, the compound may exhibit various physical properties such as melting point, solubility in polar solvents, and stability under different pH conditions, which are essential for its practical applications. Overall, 3-(3-Aminophenyl)-4-pyridinecarboxylic acid represents a versatile scaffold for further chemical modifications and research into its biological activities.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c13-9-3-1-2-8(6-9)11-7-14-5-4-10(11)12(15)16/h1-7H,13H2,(H,15,16)

InChI key: InChIKey=SBAYRIRZHQHNPF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=CC1)C2=CC(N)=CC=C2

Synonyms:

• 3-(3-Aminophenyl)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 3-(3-aminophenyl)-