
CAS 1261966-90-8
:3-[4-Chloro-3-(methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid
Description:
3-[4-Chloro-3-(methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid, with the CAS number 1261966-90-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a chloro and a methoxycarbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The chloro substituent can influence its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. The methoxycarbonyl group introduces a carboxylic acid functionality, which can participate in hydrogen bonding and may affect solubility in polar solvents. Additionally, the presence of both the pyridine and phenyl rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may exhibit biological activity. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.
Formula:C14H10ClNO4
InChI:InChI=1S/C14H10ClNO4/c1-20-14(19)10-7-8(4-5-11(10)15)9-3-2-6-16-12(9)13(17)18/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=NPSDWAVNNYLRKH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=N1)C2=CC(C(OC)=O)=C(Cl)C=C2
Synonyms:- 3-[4-Chloro-3-(methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 3-[4-chloro-3-(methoxycarbonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.