CAS 1261967-16-1

2-Chloro-5-(2-formylphenyl)-3-pyridinecarboxylic acid

Description:

2-Chloro-5-(2-formylphenyl)-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and a chloro substituent. The presence of the formyl group on the phenyl ring indicates that it can participate in various chemical reactions, such as nucleophilic addition or condensation reactions. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the chloro substituent may influence its reactivity and interaction with other molecules. The pyridine ring contributes to the compound's aromaticity and potential basicity, which can affect its behavior in biological systems or as a ligand in coordination chemistry. Additionally, the compound may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique structural features suggest potential applications in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₃H₈ClNO₃

InChI: InChI=1S/C13H8ClNO3/c14-12-11(13(17)18)5-9(6-15-12)10-4-2-1-3-8(10)7-16/h1-7H,(H,17,18)

InChI key: InChIKey=YCTRXOPNMCXCIX-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C=2C=C(C(O)=O)C(Cl)=NC2)C=CC=C1

Synonyms:

• 2-Chloro-5-(2-formylphenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-chloro-5-(2-formylphenyl)-