
CAS 1261967-22-9
:4′-Methoxy-3′,4-dimethyl[1,1′-biphenyl]-3-ol
Description:
4′-Methoxy-3′,4-dimethyl[1,1′-biphenyl]-3-ol, identified by its CAS number 1261967-22-9, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) and two methyl groups (-CH3) on the biphenyl framework contributes to its unique chemical properties. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl, which enhances its polarity and potential for hydrogen bonding. The substitution pattern on the biphenyl ring influences its solubility, reactivity, and potential biological activity. Generally, compounds with such structural features may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 4′-Methoxy-3′,4-dimethyl[1,1′-biphenyl]-3-ol represents a complex organic molecule with diverse applications in research and industry.
Formula:C15H16O2
InChI:InChI=1S/C15H16O2/c1-10-4-5-13(9-14(10)16)12-6-7-15(17-3)11(2)8-12/h4-9,16H,1-3H3
InChI key:InChIKey=XFLUGFXZLFFOPX-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1OC)C2=CC(O)=C(C)C=C2
Synonyms:- 4′-Methoxy-3′,4-dimethyl[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 4′-methoxy-3′,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.