
CAS 1261967-87-6
:5-[3-(Hydroxymethyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid
Description:
5-[3-(Hydroxymethyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid, identified by its CAS number 1261967-87-6, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a methoxy group, along with a hydroxymethyl-phenyl moiety. This compound exhibits characteristics typical of aromatic carboxylic acids, including potential acidity due to the carboxyl group, which can donate protons in solution. The presence of the methoxy group may influence its solubility and reactivity, often enhancing lipophilicity. The hydroxymethyl group on the phenyl ring can participate in hydrogen bonding, affecting the compound's interactions with other molecules. This structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the presence of functional groups that can engage in various chemical reactions. Additionally, the compound's unique arrangement of substituents may confer specific biological activities, making it of interest in medicinal chemistry and related fields. Further studies would be necessary to elucidate its complete chemical behavior and potential applications.
Formula:C14H13NO4
InChI:InChI=1S/C14H13NO4/c1-19-13-12(14(17)18)6-11(7-15-13)10-4-2-3-9(5-10)8-16/h2-7,16H,8H2,1H3,(H,17,18)
InChI key:InChIKey=DEYGWALDDPHODT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1OC)C2=CC(CO)=CC=C2
Synonyms:- 3-Pyridinecarboxylic acid, 5-[3-(hydroxymethyl)phenyl]-2-methoxy-
- 5-[3-(Hydroxymethyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.