CAS 1261969-09-8: 6-Chloro-2′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description: 6-Chloro-2′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 6-position and a methyl group at the 2′-position of the biphenyl framework contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different environments. Additionally, the presence of halogen and functional groups can affect its reactivity and stability, making it a subject of interest in both synthetic and medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₄H₁₁ClO₂

InChI: InChI=1S/C14H11ClO2/c1-9-4-2-3-5-11(9)12-8-10(14(16)17)6-7-13(12)15/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=GZGJWYGJMXLWNZ-UHFFFAOYSA-N

SMILES: O=C(O)C1=CC=C(Cl)C(=C1)C=2C=CC=CC2C

4-Chloro-3-(2-methylphenyl)benzoic acid

CAS: 1261969-09-8

• Purity: 97%
• Molecular weight: 246.69000244140625

4-Chloro-3-(2-methylphenyl)benzoic acid

CAS: 1261969-09-8

Please enquire for more information about 4-Chloro-3-(2-methylphenyl)benzoic acid including the price, delivery time and more …

• Formula: C₁₄H₁₁ClO₂
• Purity: Min. 95%
• Molecular weight: 246.69 g/mol