CymitQuimica logo

CAS 1261969-09-8

:

6-Chloro-2′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:
6-Chloro-2′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 6-position and a methyl group at the 2′-position of the biphenyl framework contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different environments. Additionally, the presence of halogen and functional groups can affect its reactivity and stability, making it a subject of interest in both synthetic and medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C14H11ClO2
InChI:InChI=1S/C14H11ClO2/c1-9-4-2-3-5-11(9)12-8-10(14(16)17)6-7-13(12)15/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=GZGJWYGJMXLWNZ-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(C(O)=O)=CC1)C2=C(C)C=CC=C2
Synonyms:
  • 6-Chloro-2′-methyl[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 6-chloro-2′-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.