CAS 1261969-13-4

1,6-Dihydro-6-oxo-5-[4-[[(phenylmethoxy)carbonyl]amino]phenyl]-3-pyridinecarboxylic acid

Description:

1,6-Dihydro-6-oxo-5-[4-[[(phenylmethoxy)carbonyl]amino]phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261969-13-4, is a synthetic organic compound that features a complex structure incorporating both pyridine and aromatic moieties. This compound is characterized by the presence of a pyridine ring, which contributes to its potential biological activity, and a carboxylic acid functional group that may influence its solubility and reactivity. The presence of the phenylmethoxycarbonyl group suggests that it may have applications in medicinal chemistry, possibly as a prodrug or in the development of pharmaceuticals. The compound's structure indicates potential for hydrogen bonding and π-π interactions, which could affect its binding affinity in biological systems. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its versatility in research and application. Overall, this compound's unique structural features position it as a candidate for further investigation in drug development and related fields.

Formula: C₂₀H₁₆N₂O₅

InChI: InChI=1S/C20H16N2O5/c23-18-17(10-15(11-21-18)19(24)25)14-6-8-16(9-7-14)22-20(26)27-12-13-4-2-1-3-5-13/h1-11H,12H2,(H,21,23)(H,22,26)(H,24,25)

InChI key: InChIKey=FDFICOLUFVXGHT-UHFFFAOYSA-N

SMILES: O=C1C(=CC(C(O)=O)=CN1)C2=CC=C(NC(OCC3=CC=CC=C3)=O)C=C2

Synonyms:

• 1,6-Dihydro-6-oxo-5-[4-[[(phenylmethoxy)carbonyl]amino]phenyl]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 1,6-dihydro-6-oxo-5-[4-[[(phenylmethoxy)carbonyl]amino]phenyl]-