CAS 1261969-27-0

6-Chloro-4′-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

6-Chloro-4′-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, potentially participating in various chemical reactions, including esterification and neutralization. The compound features a chloro substituent at the 6-position and a methoxy group (-OCH3) at the 4′ position, which can influence its reactivity and solubility. Additionally, the trifluoromethyl group (-CF3) at the 3′ position enhances the compound's lipophilicity and may affect its biological activity. This compound is likely to exhibit unique properties due to the combination of these functional groups, making it of interest in fields such as medicinal chemistry and materials science. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and potential uses in pharmaceuticals or agrochemicals.

Formula: C₁₅H₁₀ClF₃O₃

InChI: InChI=1S/C15H10ClF3O3/c1-22-13-5-3-8(7-11(13)15(17,18)19)10-6-9(14(20)21)2-4-12(10)16/h2-7H,1H3,(H,20,21)

InChI key: InChIKey=VBBKKXZCXUIKAV-UHFFFAOYSA-N

SMILES: ClC=1C(C2=CC(C(F)(F)F)=C(OC)C=C2)=CC(C(O)=O)=CC1

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 6-chloro-4′-methoxy-3′-(trifluoromethyl)-
• 6-Chloro-4′-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid