CymitQuimica logo

CAS 1261969-29-2

:

2′-Chloro-3,5′-dihydroxy[1,1′-biphenyl]-4-carboxaldehyde

Description:
2′-Chloro-3,5′-dihydroxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and hydroxyl groups at the 3′ and 5′ positions contributes to its reactivity and potential applications in various chemical reactions. The aldehyde functional group at the 4-position enhances its electrophilic character, making it suitable for further derivatization. This compound may exhibit properties such as solubility in organic solvents, and its hydroxyl groups can participate in hydrogen bonding, influencing its physical properties. Additionally, the chlorine substituent can affect the compound's electronic properties and reactivity. Due to its structural features, it may be of interest in fields such as medicinal chemistry, materials science, or as a potential intermediate in organic synthesis. However, specific applications and biological activities would require further investigation and characterization.
Formula:C13H9ClO3
InChI:InChI=1S/C13H9ClO3/c14-12-4-3-10(16)6-11(12)8-1-2-9(7-15)13(17)5-8/h1-7,16-17H
InChI key:InChIKey=XAWAOROGXMKRFC-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(O)=C(C=O)C=C2)C=C(O)C=C1
Synonyms:
  • 2′-Chloro-3,5′-dihydroxy[1,1′-biphenyl]-4-carboxaldehyde
  • [1,1′-Biphenyl]-4-carboxaldehyde, 2′-chloro-3,5′-dihydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.