CAS 1261969-58-7
:5-Chloro-2′-fluoro[1,1′-biphenyl]-3-ol
Description:
5-Chloro-2′-fluoro[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position of the biphenyl framework contributes to its classification as a phenolic compound, which can exhibit various chemical properties such as acidity and reactivity with electrophiles. The chlorine atom at the 5-position and the fluorine atom at the 2′-position introduce halogen substituents that can influence the compound's electronic properties, potentially enhancing its reactivity and altering its physical characteristics, such as solubility and boiling point. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic applications. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity when handling or utilizing it in research or industrial processes.
Formula:C12H8ClFO
InChI:InChI=1S/C12H8ClFO/c13-9-5-8(6-10(15)7-9)11-3-1-2-4-12(11)14/h1-7,15H
InChI key:InChIKey=VDHDZHOOPKAUOP-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C2=CC(Cl)=CC(O)=C2
Synonyms:- 5-Chloro-2′-fluoro[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-chloro-2′-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
