CAS 1261969-59-8

2-Methyl-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

2-Methyl-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a carboxylic acid group and a pyrrolidinylsulfonyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its functional groups, which may interact with biological targets. The presence of the carboxylic acid group suggests acidic properties, while the sulfonyl group can enhance solubility and reactivity. The methyl group contributes to the compound's steric and electronic characteristics, potentially influencing its pharmacological profile. As a synthetic organic compound, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific applications and behavior in biological systems would depend on further studies, including its mechanism of action, toxicity, and efficacy in relevant assays. Overall, this compound represents a class of molecules that could have significant implications in drug discovery and development.

Formula: C₁₈H₁₉NO₄S

InChI: InChI=1S/C18H19NO4S/c1-13-11-15(18(20)21)7-8-17(13)14-5-4-6-16(12-14)24(22,23)19-9-2-3-10-19/h4-8,11-12H,2-3,9-10H2,1H3,(H,20,21)

InChI key: InChIKey=BJMHGVQZOZUPCU-UHFFFAOYSA-N

SMILES: CC1=C(C=CC(C(O)=O)=C1)C2=CC(S(=O)(=O)N3CCCC3)=CC=C2

Synonyms:

• 2-Methyl-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2-methyl-3′-(1-pyrrolidinylsulfonyl)-