CAS 1261970-23-3

4′-Chloro-2-fluoro-2′-methoxy[1,1′-biphenyl]-4-carboxylic acid

Description:

4′-Chloro-2-fluoro-2′-methoxy[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a carboxylic acid group (-COOH), a methoxy group (-OCH3), and halogen substituents (chlorine and fluorine) on the biphenyl framework. The presence of these substituents can significantly influence the compound's chemical reactivity, solubility, and potential biological activity. The chlorine and fluorine atoms introduce electronegative elements that can affect the compound's polarity and interaction with other molecules. Additionally, the methoxy group can enhance solubility in organic solvents. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential applications. As with many chemical substances, safety and handling precautions should be observed, particularly due to the presence of halogenated groups, which may pose environmental and health risks.

Formula: C₁₄H₁₀ClFO₃

InChI: InChI=1S/C14H10ClFO3/c1-19-13-7-9(15)3-5-11(13)10-4-2-8(14(17)18)6-12(10)16/h2-7H,1H3,(H,17,18)

InChI key: InChIKey=NTPHDXJBZNTXRR-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(Cl)=C1)C2=C(F)C=C(C(O)=O)C=C2

Synonyms:

• 4′-Chloro-2-fluoro-2′-methoxy[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 4′-chloro-2-fluoro-2′-methoxy-

4-(4-Chloro-2-methoxyphenyl)-3-fluorobenzoic acid

CAS: 1261970-23-3

Formula: C₁₄H₁₀ClFO₃

Molecular weight: 280.6788

Ref: IN-DA000SAC