
CAS 1261970-66-4
:3′,5′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid
Description:
3′,5′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms and one fluorine atom on the biphenyl framework indicates that it is a halogenated compound, which can influence its reactivity and biological activity. The carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents. This compound may exhibit specific properties such as potential antimicrobial or herbicidal activity, making it of interest in agricultural and pharmaceutical applications. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of multiple halogen substituents can affect its environmental persistence and toxicity. As with many halogenated compounds, careful handling and assessment of its environmental impact are essential.
Formula:C13H7Cl2FO2
InChI:InChI=1S/C13H7Cl2FO2/c14-9-3-8(4-10(15)6-9)11-2-1-7(13(17)18)5-12(11)16/h1-6H,(H,17,18)
InChI key:InChIKey=PNQIPNNJHMDZGD-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(O)=O)=C1)C2=CC(Cl)=CC(Cl)=C2
Synonyms:- 3′,5′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 3′,5′-dichloro-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.