CAS 1261970-85-7
:3-Chloro-2′-formyl[1,1′-biphenyl]-4-carboxylic acid
Description:
3-Chloro-2′-formyl[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3-position and a formyl group at the 2′-position, along with a carboxylic acid functional group at the 4-position, contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in polar solvents. The chloro substituent may also affect the electronic properties of the molecule, potentially making it a useful intermediate in the synthesis of more complex organic compounds. Additionally, the structural features suggest that it could be involved in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in medicinal chemistry and materials science. Its specific properties, such as melting point, boiling point, and spectral data, would need to be referenced from experimental sources for detailed applications.
Formula:C14H9ClO3
InChI:InChI=1S/C14H9ClO3/c15-13-7-9(5-6-12(13)14(17)18)11-4-2-1-3-10(11)8-16/h1-8H,(H,17,18)
InChI key:InChIKey=RFBKSOMVEFJZES-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C2=CC(Cl)=C(C(O)=O)C=C2)C=CC=C1
Synonyms:- 3-Chloro-2′-formyl[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 3-chloro-2′-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
